| Product Name | 2-Phenyl-2-pentenal |
| CAS No. | 3491-63-2 |
| Synonyms | Benzeneacetaldehyde, alpha-propylidene-; (2E)-2-phenylpent-2-enal |
| InChI | InChI=1/C11H12O/c1-2-6-11(9-12)10-7-4-3-5-8-10/h3-9H,2H2,1H3/b11-6- |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.2124 |
| Density | 0.976g/cm3 |
| Boiling point | 286.7°C at 760 mmHg |
| Flash point | 106.2°C |
| Refractive index | 1.524 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
3491-63-2 2-phenyl-2-pentenal
service@apichina.com