| Product Name | 2-Phenyl-2-morpholinoacetonitrile |
| CAS No. | 15190-10-0 |
| Synonyms | alpha-(4-Morpholino)phenylacetonitrile; morpholin-4-yl(phenyl)acetonitrile |
| InChI | InChI=1/C12H14N2O/c13-10-12(11-4-2-1-3-5-11)14-6-8-15-9-7-14/h1-5,12H,6-9H2 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.2524 |
| Density | 1.139g/cm3 |
| Boiling point | 306.1°C at 760 mmHg |
| Flash point | 138.9°C |
| Refractive index | 1.559 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
15190-10-0 2-phenyl-2-morpholinoacetonitrile
service@apichina.com