| Product Name | 2-phenyl-1H-imidazole-4-carbaldehyde |
| CAS No. | 68282-47-3 |
| Synonyms | 2-phenyl-1H-imidazole-5-carbaldehyde |
| InChI | InChI=1/C10H8N2O/c13-7-9-6-11-10(12-9)8-4-2-1-3-5-8/h1-7H,(H,11,12) |
| Molecular Formula | C10H8N2O |
| Molecular Weight | 172.1833 |
| Density | 1.248g/cm3 |
| Melting point | 167℃ |
| Boiling point | 418.9°C at 760 mmHg |
| Flash point | 208.7°C |
| Refractive index | 1.646 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R21/22:Harmful in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
68282-47-3 2-phenyl-1h-imidazole-4-carbaldehyde
service@apichina.com