| Sales Email | Service@apichina.com |
| CAS No. | 36094-04-9 |
| Product Name | 2-phenyl-1,3-thiazole-4-carbonyl chloride |
| InChI | InChI=1/C10H6ClNOS/c11-9(13)8-6-14-10(12-8)7-4-2-1-3-5-7/h1-6H |
| Molecular Formula | C10H6ClNOS |
| Molecular Weight | 223.6787 |
| Density | 1.365g/cm3 |
| Melting point | 99℃ |
| Boiling point | 358.3°C at 760 mmHg |
| Flash point | 170.5°C |
| Refractive index | 1.62 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
