| Product Name | 2-phenyl-1,3-thiazole-4-carbaldehyde |
| CAS No. | 20949-81-9 |
| Synonyms | 2-phenylthiazole-4-carbaldehyde |
| InChI | InChI=1/C10H7NOS/c12-6-9-7-13-10(11-9)8-4-2-1-3-5-8/h1-7H |
| Molecular Formula | C10H7NOS |
| Molecular Weight | 189.2337 |
| Density | 1.269g/cm3 |
| Melting point | 45℃ |
| Boiling point | 353°C at 760 mmHg |
| Flash point | 167.3°C |
| Refractive index | 1.645 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
20949-81-9 2-phenyl-1,3-thiazole-4-carbaldehyde
service@apichina.com