| Product Name | 2-phenyl-1,3-dithiane |
| CAS No. | 5425-44-5 |
| Synonyms | m-Dithiane, 2-phenyl-; 1,3-Dithiane, 2-phenyl-; 2-Phenyl-1,3-dithiane; 2-Phenyl-m-dithiane; 5-19-01-00462 (Beilstein Handbook Reference); BRN 0130879; NSC 12763; 1,3-Dithiane, 2-phenyl- (9CI) |
| InChI | InChI=1/C10H12S2/c1-2-5-9(6-3-1)10-11-7-4-8-12-10/h1-3,5-6,10H,4,7-8H2 |
| Molecular Formula | C10H12S2 |
| Molecular Weight | 196.3323 |
| Density | 1.157g/cm3 |
| Boiling point | 326.8°C at 760 mmHg |
| Flash point | 158.3°C |
| Refractive index | 1.615 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
5425-44-5 2-phenyl-1,3-dithiane
service@apichina.com