| Product Name | 2-Phenoxyethyl methacrylate |
| CAS No. | 10595-06-9 |
| InChI | InChI=1/C12H14O3/c1-9(2)12(13)15-10(3)14-11-7-5-4-6-8-11/h4-8,10H,1H2,2-3H3 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.2378 |
| Density | 1.059g/cm3 |
| Boiling point | 292.352°C at 760 mmHg |
| Flash point | 118.277°C |
| Refractive index | 1.501 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S28:After contact with skin, wash immediately with plenty of ...; |
10595-06-9 2-phenoxyethyl methacrylate
service@apichina.com