| Product Name | 2-phenoxybutyric acid |
| CAS No. | 13794-14-4 |
| Synonyms | Butyric acid, 2-phenoxy-; 3-06-00-00616 (Beilstein Handbook Reference); BRN 2048912; Butanoic acid, 2-phenoxy-; DL-2-Phenoxybutyric acid; alpha-Phenoxybutyric acid; 2-Phenoxybutyric acid; 2-phenoxybutanoic acid; (2S)-2-phenoxybutanoic acid |
| InChI | InChI=1/C10H12O3/c1-2-9(10(11)12)13-8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H,11,12)/t9-/m0/s1 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.2005 |
| Density | 1.14g/cm3 |
| Melting point | 79-83℃ |
| Boiling point | 258°C at 760 mmHg |
| Flash point | 115.3°C |
| Refractive index | 1.524 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
13794-14-4 2-phenoxybutyric acid
service@apichina.com