| Product Name | 2-Phenoxybenzoic acid |
| CAS No. | 2243-42-7 |
| Synonyms | 2-Carboxydiphenyl ether; 2-phenoxybenzoate |
| InChI | InChI=1/C13H10O3/c14-13(15)11-8-4-5-9-12(11)16-10-6-2-1-3-7-10/h1-9H,(H,14,15)/p-1 |
| Molecular Formula | C13H9O3 |
| Molecular Weight | 213.2093 |
| Melting point | 111-115℃ |
| Boiling point | 343.3°C at 760 mmHg |
| Flash point | 132°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
2243-42-7 2-phenoxybenzoic acid
service@apichina.com