| Product Name | 2-(Penthamethylbenzoyl)benzoic acid |
| CAS No. | 111385-66-1 |
| Synonyms | 2-(Pentamethylbenzoyl)benzoic acid; benzoic acid, 2-(2,3,4,5,6-pentamethylbenzoyl)- |
| InChI | InChI=1/C19H20O3/c1-10-11(2)13(4)17(14(5)12(10)3)18(20)15-8-6-7-9-16(15)19(21)22/h6-9H,1-5H3,(H,21,22) |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.3603 |
| Density | 1.133g/cm3 |
| Melting point | 284℃ |
| Boiling point | 493.3°C at 760 mmHg |
| Flash point | 266.2°C |
| Refractive index | 1.58 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
111385-66-1 2-(penthamethylbenzoyl)benzoic acid
service@apichina.com