| Product Name | 2-Octenoic acid |
| CAS No. | 1871-67-6 |
| Synonyms | Octenoicacidpract; 2-Octenoic acid,predominantly trans; trans-2-Octenoic acid; oct-2-enoate |
| InChI | InChI=1/C8H14O2/c1-2-3-4-5-6-7-8(9)10/h6-7H,2-5H2,1H3,(H,9,10)/p-1 |
| Molecular Formula | C8H13O2 |
| Molecular Weight | 141.1882 |
| Melting point | 5-6℃ |
| Boiling point | 260.2°C at 760 mmHg |
| Flash point | 151.1°C |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S25:Avoid contact with eyes.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
1871-67-6 2-octenoic acid
service@apichina.com