| Product Name | 2-Nonenoic acid |
| CAS No. | 3760-11-0 |
| Synonyms | trans-2-Nonenoic acid; (2Z)-non-2-enoic acid |
| InChI | InChI=1/C9H16O2/c1-2-3-4-5-6-7-8-9(10)11/h7-8H,2-6H2,1H3,(H,10,11)/b8-7- |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.2221 |
| Density | 0.944g/cm3 |
| Boiling point | 261.5°C at 760 mmHg |
| Flash point | 168.3°C |
| Refractive index | 1.46 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
3760-11-0 2-nonenoic acid
service@apichina.com