| Product Name | 2-Nitrothiophene-4-carboxylic acid |
| CAS No. | 40357-96-8 |
| Synonyms | 5-Nitrothiophene-3-carboxylic acid; 5-nitrothiophene-3-carboxylate |
| InChI | InChI=1/C5H3NO4S/c7-5(8)3-1-4(6(9)10)11-2-3/h1-2H,(H,7,8)/p-1 |
| Molecular Formula | C5H2NO4S |
| Molecular Weight | 172.1392 |
| Melting point | 145-146℃ |
| Boiling point | 367.2°C at 760 mmHg |
| Flash point | 175.9°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
40357-96-8 2-nitrothiophene-4-carboxylic acid
service@apichina.com