| Product Name | 2-Nitrosotoluene |
| CAS No. | 611-23-4 |
| Synonyms | 1-Methyl-2-nitrosobenzene; 2-Methyl-1-nitrosobenzene; 2-Methylnitrosobenzene; 4-05-00-00844 (Beilstein Handbook Reference); BRN 1927295; CCRIS 480; NSC 66507; o-Methylnitrosobenzene; o-Nitrosotoluene; Benzene, 1-methyl-2-nitroso- (9CI); Toluene, o-nitroso- |
| InChI | InChI=1/C7H7NO/c1-6-4-2-3-5-7(6)8-9/h2-5H,1H3 |
| Molecular Formula | C7H7NO |
| Molecular Weight | 121.1366 |
| Density | 1.03g/cm3 |
| Melting point | 70-75℃ |
| Boiling point | 199.9°C at 760 mmHg |
| Flash point | 74.7°C |
| Refractive index | 1.524 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
611-23-4 2-nitrosotoluene
service@apichina.com