| Product Name | 2-Nitrophenylthiourea |
| CAS No. | 51039-84-0 |
| Synonyms | Thiourea, (2-nitrophenyl)-; 1-(2-nitrophenyl)thiourea |
| InChI | InChI=1/C7H7N3O2S/c8-7(13)9-5-3-1-2-4-6(5)10(11)12/h1-4H,(H3,8,9,13) |
| Molecular Formula | C7H7N3O2S |
| Molecular Weight | 197.2144 |
| Density | 1.524g/cm3 |
| Boiling point | 350.6°C at 760 mmHg |
| Flash point | 165.8°C |
| Refractive index | 1.759 |
| Risk Codes | R25:Toxic if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
51039-84-0 2-nitrophenylthiourea
service@apichina.com