| Product Name | 2-Nitrophenylhydrazine |
| CAS No. | 3034-19-3 |
| Synonyms | BRN 0512797; Hydrazine, (o-nitrophenyl)- |
| InChI | InChI=1/C6H7N3O2/c7-8-5-3-1-2-4-6(5)9(10)11/h1-4,8H,7H2 |
| Molecular Formula | C6H7N3O2 |
| Molecular Weight | 153.1387 |
| Density | 1.419g/cm3 |
| Melting point | 89-94℃ |
| Boiling point | 314.3°C at 760 mmHg |
| Flash point | 143.9°C |
| Refractive index | 1.691 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; R5:Heating may cause an explosion.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
3034-19-3 2-nitrophenylhydrazine
service@apichina.com