| Product Name | 2-Nitrophenyl isothiocyanate |
| CAS No. | 2719-30-4 |
| Synonyms | 1-isocyanato-2-nitrobenzene; 1-isothiocyanato-2-nitrobenzene |
| InChI | InChI=1/C7H4N2O2S/c10-9(11)7-4-2-1-3-6(7)8-5-12/h1-4H |
| Molecular Formula | C7H4N2O2S |
| Molecular Weight | 180.1839 |
| Density | 1.33g/cm3 |
| Boiling point | 325.3°C at 760 mmHg |
| Flash point | 150.5°C |
| Refractive index | 1.631 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
2719-30-4 2-nitrophenyl isothiocyanate
service@apichina.com