| Product Name | 2-nitrophenyl acetate |
| CAS No. | 610-69-5 |
| Synonyms | 2-Nitrophenyl acetate; Acetic acid 2-nitrophenyl ester |
| InChI | InChI=1/C8H7NO4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3 |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.1455 |
| Density | 1.304g/cm3 |
| Melting point | 39-41℃ |
| Boiling point | 274.8°C at 760 mmHg |
| Flash point | 139.8°C |
| Refractive index | 1.548 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
610-69-5 2-nitrophenyl acetate
service@apichina.com