| Product Name | 2-Nitronaphthalene |
| CAS No. | 581-89-5 |
| Synonyms | 2-Nitronaphthalene (purity) |
| InChI | InChI=1/C10H7NO2/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h1-7H |
| Molecular Formula | C10H7NO2 |
| Molecular Weight | 173.1681 |
| Density | 1.279g/cm3 |
| Boiling point | 319.6°C at 760 mmHg |
| Flash point | 158.7°C |
| Refractive index | 1.671 |
| Hazard Symbols |  T:Toxic;  N:Dangerous for the environment; |
| Risk Codes | R45:May cause cancer.; R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.; |
| Safety | S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; S53:Avoid exposure - obtain special instructions before use.; S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.; |
581-89-5 2-nitronaphthalene
service@apichina.com