| Product Name | 2-Nitroethanol |
| CAS No. | 625-48-9 |
| Synonyms | 1-nitro-2-hydroxyethane; 2-Nitroethanol, 85% (Assay); beta-nitroalcohol; beta-nitroethyl alcohol; nitroethanol; |
| InChI | InChI=1/C2H5NO3/c4-2-1-3(5)6/h4H,1-2H2 |
| Molecular Formula | C2H5NO3 |
| Molecular Weight | 91.07 |
| Density | 1.267g/cm3 |
| Boiling point | 193.8°C at 760 mmHg |
| Flash point | 113.8°C |
| Refractive index | 1.438 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
625-48-9 2-nitroethanol
service@apichina.com
- Next:625-50-3 n-ethylacetamide
- Previous:625-47-8 1-chloro-2-nitroethane