| Sales Email | Service@apichina.com |
| CAS No. | 606-26-8 |
| Product Name | 2-Nitrobenzhydrazide |
| Synonyms | 2-Nitrobenzoic hydrazide; 2-Nitrobenzoyl hydrazide; 2-nitrobenzohydrazide |
| InChI | InChI=1/C7H7N3O3/c8-9-7(11)5-3-1-2-4-6(5)10(12)13/h1-4H,8H2,(H,9,11) |
| Molecular Formula | C7H7N3O3 |
| Molecular Weight | 181.1488 |
| Density | 1.406g/cm3 |
| Melting point | 123℃ |
| Refractive index | 1.621 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
