| Product Name | 2-Nitrobenzaldoxime |
| CAS No. | 6635-41-2 |
| Synonyms | 2-Nitrobenzaldoxime, (2-Nitrobenzaldehyde oxime); 2-Nitrobenzaldehyde oxime; N-hydroxy-1-(2-nitrophenyl)methanimine |
| InChI | InChI=1/C7H6N2O3/c10-8-5-6-3-1-2-4-7(6)9(11)12/h1-5,10H/b8-5- |
| Molecular Formula | C7H6N2O3 |
| Molecular Weight | 166.1341 |
| Density | 1.33g/cm3 |
| Melting point | 98-100℃ |
| Boiling point | 305.2°C at 760 mmHg |
| Flash point | 138.4°C |
| Refractive index | 1.589 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
6635-41-2 2-nitrobenzaldoxime
service@apichina.com