| Product Name | 2-Nitroacetanilide |
| CAS No. | 552-32-9 |
| Synonyms | o-Nitroacetanilide; 2'-Nitroacetanilide; AI3-08843; NSC 1313; Acetamide, N-(2-nitrophenyl)-; Acetanilide, 2'-nitro- (8CI); N-(2-nitrophenyl)acetamide |
| InChI | InChI=1/C8H8N2O3/c1-6(11)9-7-4-2-3-5-8(7)10(12)13/h2-5H,1H3,(H,9,11) |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.1607 |
| Density | 1.34g/cm3 |
| Melting point | 92-94℃ |
| Boiling point | 388.1°C at 760 mmHg |
| Flash point | 188.5°C |
| Refractive index | 1.617 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
552-32-9 2-nitroacetanilide
service@apichina.com