| Product Name | 2-nitro-9-fluorenone |
| CAS No. | 3096-52-4 |
| Synonyms | 2-Nitro-9-fluorenone; 4-07-00-01636 (Beilstein Handbook Reference); BRN 2052959; CCRIS 2540; NSC 12365; 9H-Fluoren-9-one, 2-nitro-; 2-nitro-9H-fluoren-9-one |
| InChI | InChI=1/C13H7NO3/c15-13-11-4-2-1-3-9(11)10-6-5-8(14(16)17)7-12(10)13/h1-7H |
| Molecular Formula | C13H7NO3 |
| Molecular Weight | 225.1996 |
| Density | 1.437g/cm3 |
| Melting point | 222-223℃ |
| Boiling point | 419°C at 760 mmHg |
| Flash point | 215.1°C |
| Refractive index | 1.698 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
3096-52-4 2-nitro-9-fluorenone
service@apichina.com