| Product Name | 2-Naphthyl tetradecanoate |
| CAS No. | 7262-80-8 |
| Synonyms | 2-Naphthyl myristate~Tetradecanoic acid 2-naphthyl ester; naphthalen-2-yl tetradecanoate |
| InChI | InChI=1/C24H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-17-24(25)26-23-19-18-21-15-13-14-16-22(21)20-23/h13-16,18-20H,2-12,17H2,1H3 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.5256 |
| Density | 0.986g/cm3 |
| Boiling point | 473.1°C at 760 mmHg |
| Flash point | 147.8°C |
| Refractive index | 1.53 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
7262-80-8 2-naphthyl tetradecanoate
service@apichina.com