| Product Name | 2-Naphthoic hydrazide |
| CAS No. | 39627-84-4 |
| Synonyms | 2-Naphthoic hydrazide, (2-Naphthoylhydrazine); 2-Naphthoylhydrazine; 2-Naphthhydrazide; naphthalene-2-carbohydrazide |
| InChI | InChI=1/C11H10N2O/c12-13-11(14)10-6-5-8-3-1-2-4-9(8)7-10/h1-7H,12H2,(H,13,14) |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.2099 |
| Density | 1.232g/cm3 |
| Refractive index | 1.672 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
39627-84-4 2-naphthoic hydrazide
service@apichina.com