| Product Name | 2-(n-Pentylthio)nicotinic acid |
| CAS No. | 175135-23-6 |
| Synonyms | 2-(n-Amylmercapto)nicotinic acid~2-(n-Amylthio)nicotinic acid~2-(n-Pentylthio)pyridine-3-carboxylic acid; 2-(n-Amylthio)nicotinic acid; 2-(pentylsulfanyl)pyridine-3-carboxylic acid; 2-(pentylsulfanyl)pyridine-3-carboxylate |
| InChI | InChI=1/C11H15NO2S/c1-2-3-4-8-15-10-9(11(13)14)6-5-7-12-10/h5-7H,2-4,8H2,1H3,(H,13,14)/p-1 |
| Molecular Formula | C11H14NO2S |
| Molecular Weight | 224.2999 |
| Melting point | 118℃ |
| Boiling point | 372.6°C at 760 mmHg |
| Flash point | 179.1°C |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
175135-23-6 2-(n-pentylthio)nicotinic acid
service@apichina.com