| Product Name | 2-morpholinobenzoic acid |
| CAS No. | 42106-48-9 |
| Synonyms | 2-morpholin-4-ylbenzoic acid |
| InChI | InChI=1/C11H13NO3/c13-11(14)9-3-1-2-4-10(9)12-5-7-15-8-6-12/h1-4H,5-8H2,(H,13,14) |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.2258 |
| Density | 1.253g/cm3 |
| Melting point | 157℃ |
| Boiling point | 387.5°C at 760 mmHg |
| Flash point | 188.2°C |
| Refractive index | 1.579 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
42106-48-9 2-morpholinobenzoic acid
service@apichina.com