| Product Name | 2-morpholino-5-nitrobenzaldehyde |
| CAS No. | 30742-62-2 |
| Synonyms | 2-morpholin-4-yl-5-nitrobenzaldehyde |
| InChI | InChI=1/C11H12N2O4/c14-8-9-7-10(13(15)16)1-2-11(9)12-3-5-17-6-4-12/h1-2,7-8H,3-6H2 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.224 |
| Density | 1.34g/cm3 |
| Melting point | 105℃ |
| Boiling point | 437°C at 760 mmHg |
| Flash point | 218.1°C |
| Refractive index | 1.613 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
30742-62-2 2-morpholino-5-nitrobenzaldehyde
service@apichina.com