| Product Name | 2-morpholino-3-pyridinamine |
| CAS No. | 51627-47-5 |
| Synonyms | 2-morpholin-4-ylpyridin-3-amine; 3-amino-2-morpholin-4-ylpyridinium |
| InChI | InChI=1/C9H13N3O/c10-8-2-1-3-11-9(8)12-4-6-13-7-5-12/h1-3H,4-7,10H2/p+1 |
| Molecular Formula | C9H14N3O |
| Molecular Weight | 180.2264 |
| Boiling point | 381.9°C at 760 mmHg |
| Flash point | 184.8°C |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
51627-47-5 2-morpholino-3-pyridinamine
service@apichina.com