| Product Name | 2-morpholin-4-yl-N-(2-nitrophenyl)-2-oxoethanehydrazonoyl chloride |
| CAS No. | 5588-52-3 |
| InChI | InChI=1/C12H13ClN4O4/c13-11(12(18)16-5-7-21-8-6-16)15-14-9-3-1-2-4-10(9)17(19)20/h1-4,14H,5-8H2 |
| Molecular Formula | C12H13ClN4O4 |
| Molecular Weight | 312.709 |
| Density | 1.5g/cm3 |
| Boiling point | 463.3°C at 760 mmHg |
| Flash point | 234°C |
| Refractive index | 1.646 |
5588-52-3 2-morpholin-4-yl-n-(2-nitrophenyl)-2-oxoethanehydrazonoyl chloride
service@apichina.com