| Product Name | 2-Methylvaleryl chloride |
| CAS No. | 5238-27-7 |
| Synonyms | 2-Methylvaleroyl Chloride; 2-Methylpentanoyl chloride; (3Z)-4-hydroxy-4-(4-methylphenyl)-2-oxo-N-1,3-thiazol-2-ylbut-3-enamide; (2S)-2-methylpentanoyl chloride; (2R)-2-methylpentanoyl chloride |
| InChI | InChI=1/C6H11ClO/c1-3-4-5(2)6(7)8/h5H,3-4H2,1-2H3/t5-/m1/s1 |
| Molecular Formula | C6H11ClO |
| Molecular Weight | 134.6039 |
| Density | 0.986g/cm3 |
| Boiling point | 140.4°C at 760 mmHg |
| Flash point | 41.1°C |
| Refractive index | 1.422 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R10:Flammable.; R34:Causes burns.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
5238-27-7 2-methylvaleryl chloride
service@apichina.com