| Product Name | 2-(methylthio)phenyl isothiocyanate |
| CAS No. | 51333-75-6 |
| Synonyms | 2-(Methylthio)phenyl isothiocyanate; 1-isothiocyanato-2-(methylsulfanyl)benzene |
| InChI | InChI=1/C8H7NS2/c1-11-8-5-3-2-4-7(8)9-6-10/h2-5H,1H3 |
| Molecular Formula | C8H7NS2 |
| Molecular Weight | 181.2779 |
| Density | 1.13g/cm3 |
| Boiling point | 290.7°C at 760 mmHg |
| Flash point | 129.6°C |
| Refractive index | 1.603 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
51333-75-6 2-(methylthio)phenyl isothiocyanate
service@apichina.com