| Product Name | 2-(Methylthio)nicotinyl chloride |
| CAS No. | 97936-43-1 |
| Synonyms | 2-(Methylmercapto)nicotinyl chloride~2-(Methylmercapto)pyridine-3-carbonyl chloride~2-(Methylthio)pyridine-3-carbonyl chloride; 2-(methylsulfanyl)pyridine-3-carbonyl chloride |
| InChI | InChI=1/C7H6ClNOS/c1-11-7-5(6(8)10)3-2-4-9-7/h2-4H,1H3 |
| Molecular Formula | C7H6ClNOS |
| Molecular Weight | 187.6466 |
| Density | 1.35g/cm3 |
| Melting point | 88-91℃ |
| Boiling point | 294.2°C at 760 mmHg |
| Flash point | 131.8°C |
| Refractive index | 1.592 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
97936-43-1 2-(methylthio)nicotinyl chloride
service@apichina.com