| Sales Email | Service@apichina.com |
| CAS No. | 74470-23-8 |
| Product Name | 2-(Methylthio)nicotinic acid |
| Synonyms | 2-(Methylmercapto)pyridine-3-carboxylic acid~2-(Methylthio)pyridine-3-carboxylic acid; 2-(Methylmercapto)-nicotinic acid; 2-(methylsulfanyl)pyridine-3-carboxylic acid; 2-(methylsulfanyl)pyridine-3-carboxylate |
| InChI | InChI=1/C7H7NO2S/c1-11-6-5(7(9)10)3-2-4-8-6/h2-4H,1H3,(H,9,10)/p-1 |
| Molecular Formula | C7H6NO2S |
| Molecular Weight | 168.1936 |
| Melting point | 214-218℃ |
| Boiling point | 329.6°C at 760 mmHg |
| Flash point | 153.2°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
