| Product Name | 2-(Methylthio)benzonitrile |
| CAS No. | 6609-54-7 |
| Synonyms | 2-Cyanothioanisole~2-(Methylmercapto)benzonitrile; 2-(methylsulfanyl)benzonitrile |
| InChI | InChI=1/C8H7NS/c1-10-8-5-3-2-4-7(8)6-9/h2-5H,1H3 |
| Molecular Formula | C8H7NS |
| Molecular Weight | 149.2129 |
| Density | 1.14g/cm3 |
| Boiling point | 263.9°C at 760 mmHg |
| Flash point | 113.4°C |
| Refractive index | 1.589 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
6609-54-7 2-(methylthio)benzonitrile
service@apichina.com