| Product Name | 2-(methylthio)-6-nitro-1,3-benzothiazole |
| CAS No. | 3621-99-6 |
| Synonyms | 2-(methylsulfanyl)-6-nitro-1,3-benzothiazole |
| InChI | InChI=1/C8H6N2O2S2/c1-13-8-9-6-3-2-5(10(11)12)4-7(6)14-8/h2-4H,1H3 |
| Molecular Formula | C8H6N2O2S2 |
| Molecular Weight | 226.2754 |
| Density | 1.51g/cm3 |
| Melting point | 134℃ |
| Boiling point | 395.4°C at 760 mmHg |
| Flash point | 192.9°C |
| Refractive index | 1.718 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
3621-99-6 2-(methylthio)-6-nitro-1,3-benzothiazole
service@apichina.com