| Product Name | 2-methylquinoline-3,4-dicarboxylic acid |
| CAS No. | 88344-65-4 |
| InChI | InChI=1/C12H9NO4/c1-6-9(11(14)15)10(12(16)17)7-4-2-3-5-8(7)13-6/h2-5H,1H3,(H,14,15)(H,16,17) |
| Molecular Formula | C12H9NO4 |
| Molecular Weight | 231.2042 |
| Density | 1.462g/cm3 |
| Melting point | 225℃ |
| Boiling point | 411.2°C at 760 mmHg |
| Flash point | 202.5°C |
| Refractive index | 1.696 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
88344-65-4 2-methylquinoline-3,4-dicarboxylic acid
service@apichina.com