| Product Name | 2-methylquinolin-6-ol |
| CAS No. | 613-21-8 |
| Synonyms | 6-Hydroxy-2-methylquinoline; 2-Methyl-6-hydroxyquinoline; 2-Methyl-6-hydroxyquinoine |
| InChI | InChI=1/C10H9NO/c1-7-2-3-8-6-9(12)4-5-10(8)11-7/h2-6,12H,1H3 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.1846 |
| Density | 1.21g/cm3 |
| Melting point | 198℃ |
| Boiling point | 304.5°C at 760 mmHg |
| Flash point | 142.3°C |
| Refractive index | 1.666 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
613-21-8 2-methylquinolin-6-ol
service@apichina.com