| Sales Email | Service@apichina.com |
| CAS No. | 1575-74-2 |
| Product Name | 2-Methylpent-4-enoic acid |
| Synonyms | 2-Methyl-4-pentenoic acid; (2S)-2-methylpent-4-enoate; (2R)-2-methylpent-4-enoate |
| InChI | InChI=1/C6H10O2/c1-3-4-5(2)6(7)8/h3,5H,1,4H2,2H3,(H,7,8)/p-1/t5-/m1/s1 |
| Molecular Formula | C6H9O2 |
| Molecular Weight | 113.135 |
| Boiling point | 190.6°C at 760 mmHg |
| Flash point | 88.1°C |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
