| Product Name | 2-Methylcyclohexanol |
| CAS No. | 583-59-5 |
| Synonyms | 2-Methylcyclohexanol, mixture of cis and trans; 2-Methylcyclohexyl alcohol; (1R,2R)-2-methylcyclohexanol; (1R,2S)-2-methylcyclohexanol; (1S,2S)-2-methylcyclohexanol; (1S,2R)-2-methylcyclohexanol; O-methylcyclohexl alcohol; 2-metilcicloesanone |
| InChI | InChI=1/C7H14O/c1-6-4-2-3-5-7(6)8/h6-8H,2-5H2,1H3/t6-,7+/m1/s1 |
| Molecular Formula | C7H14O |
| Molecular Weight | 114.1855 |
| Density | 0.925g/cm3 |
| Melting point | -38℃ |
| Boiling point | 170.3°C at 760 mmHg |
| Flash point | 58.9°C |
| Water solubility | slightly soluble |
| Refractive index | 1.462 |
| Hazard Symbols | |
| Risk Codes | R20:; |
| Safety | S24/25:; |
583-59-5 2-methylcyclohexanol
service@apichina.com
- Next:583-60-8 2-methylcyclohexanone
- Previous:583-58-4 3,4-lutidine