| Product Name | 2-Methylbenzylmercaptan, (2-Methyl-a-toluenethiol) |
| CAS No. | 14092-00-3 |
| Synonyms | 2-Methylbenzyl mercaptan; 2-Methyl-alpha-toluenethiol; 1-methyl-2-(methylsulfanyl)benzene; (2-methylphenyl)methanethiol |
| InChI | InChI=1/C8H10S/c1-7-4-2-3-5-8(7)6-9/h2-5,9H,6H2,1H3 |
| Molecular Formula | C8H10S |
| Molecular Weight | 138.23 |
| Density | 1.015g/cm3 |
| Boiling point | 220.4°C at 760 mmHg |
| Flash point | 86.8°C |
| Refractive index | 1.558 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S36/37:Wear suitable protective clothing and gloves.; |
14092-00-3 2-methylbenzylmercaptan, (2-methyl-a-toluenethiol)
service@apichina.com