| Product Name | 2-Methylanthracene |
| CAS No. | 613-12-7 |
| Synonyms | CCRIS 2739; NSC 87376; Anthracene, 2-methyl- |
| InChI | InChI=1/C15H12/c1-11-14-8-4-2-6-12(14)10-13-7-3-5-9-15(11)13/h2-10H,1H3 |
| Molecular Formula | C15H12 |
| Molecular Weight | 192.2558 |
| Density | 1.105g/cm3 |
| Melting point | 202-206℃ |
| Boiling point | 347.2°C at 760 mmHg |
| Flash point | 157.5°C |
| Refractive index | 1.693 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
613-12-7 2-methylanthracene
service@apichina.com