| Product Name | 2-Methyl-5-phenylfuran-3-carboxylic acid |
| CAS No. | 108124-17-0 |
| Synonyms | 2-Methyl-5-phenyl-3-furoic acid; 2-methyl-5-phenylfuran-3-carboxylate |
| InChI | InChI=1/C12H10O3/c1-8-10(12(13)14)7-11(15-8)9-5-3-2-4-6-9/h2-7H,1H3,(H,13,14)/p-1 |
| Molecular Formula | C12H9O3 |
| Molecular Weight | 201.1986 |
| Melting point | 176-179℃ |
| Boiling point | 357.1°C at 760 mmHg |
| Flash point | 169.8°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
108124-17-0 2-methyl-5-phenylfuran-3-carboxylic acid
service@apichina.com