| Product Name | 2-Methyl-5-phenyl-3-furyl isocyanate |
| CAS No. | 568577-82-2 |
| Synonyms | 3-isocyanato-2-methyl-5-phenylfuran |
| InChI | InChI=1/C12H9NO2/c1-9-11(13-8-14)7-12(15-9)10-5-3-2-4-6-10/h2-7H,1H3 |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.2054 |
| Density | 1.12g/cm3 |
| Boiling point | 306.9°C at 760 mmHg |
| Flash point | 139.4°C |
| Refractive index | 1.569 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
568577-82-2 2-methyl-5-phenyl-3-furyl isocyanate
service@apichina.com