| Product Name | 2-Methyl-3-pentanol |
| CAS No. | 565-67-3 |
| Synonyms | Ethyl isopropyl carbinol; 2-methylpentan-3-ol; (3S)-2-methylpentan-3-ol; (3R)-2-methylpentan-3-ol |
| InChI | InChI=1/C6H14O/c1-4-6(7)5(2)3/h5-7H,4H2,1-3H3/t6-/m1/s1 |
| Molecular Formula | C6H14O |
| Molecular Weight | 102.1748 |
| Density | 0.811g/cm3 |
| Boiling point | 126.5°C at 760 mmHg |
| Flash point | 46.1°C |
| Refractive index | 1.411 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R10:Flammable.; R37:Irritating to respiratory system.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S24/25:Avoid contact with skin and eyes.; |
565-67-3 2-methyl-3-pentanol
service@apichina.com