| Product Name | 2-methyl-3-nitrophenyl isocyanate |
| CAS No. | 23695-15-0 |
| Synonyms | 1-isocyanato-2-methyl-3-nitrobenzene |
| InChI | InChI=1/C8H6N2O3/c1-6-7(9-5-11)3-2-4-8(6)10(12)13/h2-4H,1H3 |
| Molecular Formula | C8H6N2O3 |
| Molecular Weight | 178.1448 |
| Density | 1.27g/cm3 |
| Melting point | 36-39℃ |
| Boiling point | 278.5°C at 760 mmHg |
| Flash point | 122.2°C |
| Refractive index | 1.578 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42:May cause sensitization by inhalation.; |
| Safety | S22:Do not inhale dust.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
23695-15-0 2-methyl-3-nitrophenyl isocyanate
service@apichina.com