| Product Name | 2-Methyl-3-(2-furyl)propenal |
| CAS No. | 874-66-8 |
| Synonyms | [2-Methyl-3-(2-furyl)acrolein]; 2-Methyl-3-(2-furyl)acrolein; 3-(2-Furanyl)-2-methyl-2-propenal; 3-(furan-2-yl)-2-methylprop-2-enal; (2E)-3-furan-2-yl-2-methylprop-2-enal; (2Z)-3-furan-2-yl-2-methylprop-2-enal; Cinnamon acrolein |
| InChI | InChI=1/C8H8O2/c1-7(6-9)5-8-3-2-4-10-8/h2-6H,1H3/b7-5- |
| Molecular Formula | C8H8O2 |
| Molecular Weight | 136.1479 |
| Density | 1.073g/cm3 |
| Boiling point | 220.4°C at 760 mmHg |
| Flash point | 93.1°C |
| Refractive index | 1.528 |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
874-66-8 2-methyl-3-(2-furyl)propenal
service@apichina.com