| Product Name | 2-methyl-2-vinyloxirane |
| CAS No. | 1838-94-4 |
| InChI | InChI=1/C5H8O/c1-3-5(2)4-6-5/h3H,1,4H2,2H3 |
| Molecular Formula | C5H8O |
| Molecular Weight | 84.1164 |
| Density | 1.006g/cm3 |
| Boiling point | 78.7°C at 760 mmHg |
| Refractive index | 1.54 |
| Risk Codes | R11:Highly flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S33:Take precautionary measures against static discharges.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
1838-94-4 2-methyl-2-vinyloxirane
service@apichina.com