| Product Name | 2-methyl-2-butenoic acid |
| CAS No. | 13201-46-2 |
| Synonyms | 2-Methylbut-2-enoic acid |
| InChI | InChI=1/C5H8O2/c1-3-4(2)5(6)7/h3H,1-2H3,(H,6,7) |
| Molecular Formula | C5H8O2 |
| Molecular Weight | 100.1158 |
| Density | 1.01g/cm3 |
| Melting point | 63℃ |
| Boiling point | 198.5°C at 760 mmHg |
| Flash point | 96°C |
| Refractive index | 1.45 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
13201-46-2 2-methyl-2-butenoic acid
service@apichina.com